C22H22ClF3N6O3 — CID 165392820
8-chloro-5-[2-[3-oxo-3-[4-[5-(trifluoromethyl)pyrimidin-2-yl]piperazin-1-yl]propoxy]ethyl]-2H-phthalazin-1-one (PubChem CID 165392820) has the molecular formula C22H22ClF3N6O3 and a molecular weight of 510.90 g/mol. Its IUPAC name is 8-chloro-5-[2-[3-oxo-3-[4-[5-(trifluoromethyl)pyrimidin-2-yl]piperazin-1-yl]propoxy]ethyl]-2H-phthalazin-1-one.
| Compound Name | 8-chloro-5-[2-[3-oxo-3-[4-[5-(trifluoromethyl)pyrimidin-2-yl]piperazin-1-yl]propoxy]ethyl]-2H-phthalazin-1-one |
|---|---|
| PubChem CID | 165392820 |
| Molecular Formula | C22H22ClF3N6O3 |
| Molecular Weight | 510.90 g/mol |
| Exact Mass | 510.14 |
| IUPAC Name | 8-chloro-5-[2-[3-oxo-3-[4-[5-(trifluoromethyl)pyrimidin-2-yl]piperazin-1-yl]propoxy]ethyl]-2H-phthalazin-1-one |
| SMILES | O=C(CCOCCc1ccc(Cl)c2c(=O)[nH]ncc12)N1CCN(c2ncc(C(F)(F)F)cn2)CC1 |
| InChI | InChI=1S/C22H22ClF3N6O3/c23-17-2-1-14(16-13-29-30-20(34)19(16)17)3-9-35-10-4-18(33)31-5-7-32(8-6-31)21-27-11-15(12-28-21)22(24,25)26/h1-2,11-13H,3-10H2,(H,30,34) |
| InChIKey | JRLDVIDPEOUZSR-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 104.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.90 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|