C22H24F2N6O3 — CID 165393200
5-[2-[3-[4-[5-(difluoromethyl)pyrimidin-2-yl]piperazin-1-yl]-3-oxopropoxy]ethyl]-2H-phthalazin-1-one (PubChem CID 165393200) has the molecular formula C22H24F2N6O3 and a molecular weight of 458.47 g/mol. Its IUPAC name is 5-[2-[3-[4-[5-(difluoromethyl)pyrimidin-2-yl]piperazin-1-yl]-3-oxopropoxy]ethyl]-2H-phthalazin-1-one.
| Compound Name | 5-[2-[3-[4-[5-(difluoromethyl)pyrimidin-2-yl]piperazin-1-yl]-3-oxopropoxy]ethyl]-2H-phthalazin-1-one |
|---|---|
| PubChem CID | 165393200 |
| Molecular Formula | C22H24F2N6O3 |
| Molecular Weight | 458.47 g/mol |
| Exact Mass | 458.19 |
| IUPAC Name | 5-[2-[3-[4-[5-(difluoromethyl)pyrimidin-2-yl]piperazin-1-yl]-3-oxopropoxy]ethyl]-2H-phthalazin-1-one |
| SMILES | O=C(CCOCCc1cccc2c(=O)[nH]ncc12)N1CCN(c2ncc(C(F)F)cn2)CC1 |
| InChI | InChI=1S/C22H24F2N6O3/c23-20(24)16-12-25-22(26-13-16)30-8-6-29(7-9-30)19(31)5-11-33-10-4-15-2-1-3-17-18(15)14-27-28-21(17)32/h1-3,12-14,20H,4-11H2,(H,28,32) |
| InChIKey | RSYVWXYNFNXLQG-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 104.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.47 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|