C22H22F3N5O4 — CID 165392959
4-[2-[3-oxo-3-[4-[5-(trifluoromethyl)pyrimidin-2-yl]piperazin-1-yl]propoxy]ethyl]isoindole-1,3-dione (PubChem CID 165392959) has the molecular formula C22H22F3N5O4 and a molecular weight of 477.44 g/mol. Its IUPAC name is 4-[2-[3-oxo-3-[4-[5-(trifluoromethyl)pyrimidin-2-yl]piperazin-1-yl]propoxy]ethyl]isoindole-1,3-dione.
| Compound Name | 4-[2-[3-oxo-3-[4-[5-(trifluoromethyl)pyrimidin-2-yl]piperazin-1-yl]propoxy]ethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 165392959 |
| Molecular Formula | C22H22F3N5O4 |
| Molecular Weight | 477.44 g/mol |
| Exact Mass | 477.16 |
| IUPAC Name | 4-[2-[3-oxo-3-[4-[5-(trifluoromethyl)pyrimidin-2-yl]piperazin-1-yl]propoxy]ethyl]isoindole-1,3-dione |
| SMILES | O=C1NC(=O)c2c(CCOCCC(=O)N3CCN(c4ncc(C(F)(F)F)cn4)CC3)cccc21 |
| InChI | InChI=1S/C22H22F3N5O4/c23-22(24,25)15-12-26-21(27-13-15)30-8-6-29(7-9-30)17(31)5-11-34-10-4-14-2-1-3-16-18(14)20(33)28-19(16)32/h1-3,12-13H,4-11H2,(H,28,32,33) |
| InChIKey | VSMQOHWXCXENMV-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.44 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|