C18H25ClF3N7O3 — CID 154826180
4-chloro-5-[2-[3-oxo-3-[4-[5-(trifluoromethyl)pyrimidin-2-yl]piperazin-1-yl]propoxy]ethylamino]diazinan-3-one (PubChem CID 154826180) has the molecular formula C18H25ClF3N7O3 and a molecular weight of 479.89 g/mol. Its IUPAC name is 4-chloro-5-[2-[3-oxo-3-[4-[5-(trifluoromethyl)pyrimidin-2-yl]piperazin-1-yl]propoxy]ethylamino]diazinan-3-one.
| Compound Name | 4-chloro-5-[2-[3-oxo-3-[4-[5-(trifluoromethyl)pyrimidin-2-yl]piperazin-1-yl]propoxy]ethylamino]diazinan-3-one |
|---|---|
| PubChem CID | 154826180 |
| Molecular Formula | C18H25ClF3N7O3 |
| Molecular Weight | 479.89 g/mol |
| Exact Mass | 479.17 |
| IUPAC Name | 4-chloro-5-[2-[3-oxo-3-[4-[5-(trifluoromethyl)pyrimidin-2-yl]piperazin-1-yl]propoxy]ethylamino]diazinan-3-one |
| SMILES | O=C1NNCC(NCCOCCC(=O)N2CCN(c3ncc(C(F)(F)F)cn3)CC2)C1Cl |
| InChI | InChI=1S/C18H25ClF3N7O3/c19-15-13(11-26-27-16(15)31)23-2-8-32-7-1-14(30)28-3-5-29(6-4-28)17-24-9-12(10-25-17)18(20,21)22/h9-10,13,15,23,26H,1-8,11H2,(H,27,31) |
| InChIKey | XTMLBLFOBKGNEU-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 111.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.89 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|