C25H29ClF3N7O3 — CID 154826088
4-chloro-5-[(1S)-1-[[3-oxo-3-[4-[5-(trifluoromethyl)pyrimidin-2-yl]piperazin-1-yl]propoxy]methyl]-1,3-dihydroisoindol-2-yl]diazinan-3-one (PubChem CID 154826088) has the molecular formula C25H29ClF3N7O3 and a molecular weight of 568.00 g/mol. Its IUPAC name is 4-chloro-5-[(1S)-1-[[3-oxo-3-[4-[5-(trifluoromethyl)pyrimidin-2-yl]piperazin-1-yl]propoxy]methyl]-1,3-dihydroisoindol-2-yl]diazinan-3-one.
| Compound Name | 4-chloro-5-[(1S)-1-[[3-oxo-3-[4-[5-(trifluoromethyl)pyrimidin-2-yl]piperazin-1-yl]propoxy]methyl]-1,3-dihydroisoindol-2-yl]diazinan-3-one |
|---|---|
| PubChem CID | 154826088 |
| Molecular Formula | C25H29ClF3N7O3 |
| Molecular Weight | 568.00 g/mol |
| Exact Mass | 567.20 |
| IUPAC Name | 4-chloro-5-[(1S)-1-[[3-oxo-3-[4-[5-(trifluoromethyl)pyrimidin-2-yl]piperazin-1-yl]propoxy]methyl]-1,3-dihydroisoindol-2-yl]diazinan-3-one |
| SMILES | O=C1NNCC(N2Cc3ccccc3[C@H]2COCCC(=O)N2CCN(c3ncc(C(F)(F)F)cn3)CC2)C1Cl |
| InChI | InChI=1S/C25H29ClF3N7O3/c26-22-19(13-32-33-23(22)38)36-14-16-3-1-2-4-18(16)20(36)15-39-10-5-21(37)34-6-8-35(9-7-34)24-30-11-17(12-31-24)25(27,28)29/h1-4,11-12,19-20,22,32H,5-10,13-15H2,(H,33,38)/t19?,20-,22?/m1/s1 |
| InChIKey | KGSBFVKAZJQNPP-SNCIUUNGSA-N |
| XLogP | 1.72 |
| TPSA | 102.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.00 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|