C26H30ClN7O3 — CID 154826087
6-[4-[3-[[(1R)-2-(5-chloro-6-oxodiazinan-4-yl)-1,3-dihydroisoindol-1-yl]methoxy]propanoyl]piperazin-1-yl]pyridine-3-carbonitrile (PubChem CID 154826087) has the molecular formula C26H30ClN7O3 and a molecular weight of 524.03 g/mol. Its IUPAC name is 6-[4-[3-[[(1R)-2-(5-chloro-6-oxodiazinan-4-yl)-1,3-dihydroisoindol-1-yl]methoxy]propanoyl]piperazin-1-yl]pyridine-3-carbonitrile.
| Compound Name | 6-[4-[3-[[(1R)-2-(5-chloro-6-oxodiazinan-4-yl)-1,3-dihydroisoindol-1-yl]methoxy]propanoyl]piperazin-1-yl]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 154826087 |
| Molecular Formula | C26H30ClN7O3 |
| Molecular Weight | 524.03 g/mol |
| Exact Mass | 523.21 |
| IUPAC Name | 6-[4-[3-[[(1R)-2-(5-chloro-6-oxodiazinan-4-yl)-1,3-dihydroisoindol-1-yl]methoxy]propanoyl]piperazin-1-yl]pyridine-3-carbonitrile |
| SMILES | N#Cc1ccc(N2CCN(C(=O)CCOC[C@H]3c4ccccc4CN3C3CNNC(=O)C3Cl)CC2)nc1 |
| InChI | InChI=1S/C26H30ClN7O3/c27-25-21(15-30-31-26(25)36)34-16-19-3-1-2-4-20(19)22(34)17-37-12-7-24(35)33-10-8-32(9-11-33)23-6-5-18(13-28)14-29-23/h1-6,14,21-22,25,30H,7-12,15-17H2,(H,31,36)/t21?,22-,25?/m0/s1 |
| InChIKey | HSYBJIZOORYXCQ-YGWFNULRSA-N |
| XLogP | 1.18 |
| TPSA | 113.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.03 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|