C20H26F3N7O3 — CID 154826173
6-[4-[3-[2-[[6-oxo-5-(trifluoromethyl)diazinan-4-yl]amino]ethoxy]propanoyl]piperazin-1-yl]pyridine-3-carbonitrile (PubChem CID 154826173) has the molecular formula C20H26F3N7O3 and a molecular weight of 469.47 g/mol. Its IUPAC name is 6-[4-[3-[2-[[6-oxo-5-(trifluoromethyl)diazinan-4-yl]amino]ethoxy]propanoyl]piperazin-1-yl]pyridine-3-carbonitrile.
| Compound Name | 6-[4-[3-[2-[[6-oxo-5-(trifluoromethyl)diazinan-4-yl]amino]ethoxy]propanoyl]piperazin-1-yl]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 154826173 |
| Molecular Formula | C20H26F3N7O3 |
| Molecular Weight | 469.47 g/mol |
| Exact Mass | 469.20 |
| IUPAC Name | 6-[4-[3-[2-[[6-oxo-5-(trifluoromethyl)diazinan-4-yl]amino]ethoxy]propanoyl]piperazin-1-yl]pyridine-3-carbonitrile |
| SMILES | N#Cc1ccc(N2CCN(C(=O)CCOCCNC3CNNC(=O)C3C(F)(F)F)CC2)nc1 |
| InChI | InChI=1S/C20H26F3N7O3/c21-20(22,23)18-15(13-27-28-19(18)32)25-4-10-33-9-3-17(31)30-7-5-29(6-8-30)16-2-1-14(11-24)12-26-16/h1-2,12,15,18,25,27H,3-10,13H2,(H,28,32) |
| InChIKey | JVZMNNCSJCAHJP-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 122.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.47 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|