C20H27BrN6O4 — CID 154826390
6-[4-[3-[(2S)-2-(5-bromo-6-oxodiazinan-4-yl)oxypropoxy]propanoyl]piperazin-1-yl]pyridine-3-carbonitrile (PubChem CID 154826390) has the molecular formula C20H27BrN6O4 and a molecular weight of 495.38 g/mol. Its IUPAC name is 6-[4-[3-[(2S)-2-(5-bromo-6-oxodiazinan-4-yl)oxypropoxy]propanoyl]piperazin-1-yl]pyridine-3-carbonitrile.
| Compound Name | 6-[4-[3-[(2S)-2-(5-bromo-6-oxodiazinan-4-yl)oxypropoxy]propanoyl]piperazin-1-yl]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 154826390 |
| Molecular Formula | C20H27BrN6O4 |
| Molecular Weight | 495.38 g/mol |
| Exact Mass | 494.13 |
| IUPAC Name | 6-[4-[3-[(2S)-2-(5-bromo-6-oxodiazinan-4-yl)oxypropoxy]propanoyl]piperazin-1-yl]pyridine-3-carbonitrile |
| SMILES | C[C@@H](COCCC(=O)N1CCN(c2ccc(C#N)cn2)CC1)OC1CNNC(=O)C1Br |
| InChI | InChI=1S/C20H27BrN6O4/c1-14(31-16-12-24-25-20(29)19(16)21)13-30-9-4-18(28)27-7-5-26(6-8-27)17-3-2-15(10-22)11-23-17/h2-3,11,14,16,19,24H,4-9,12-13H2,1H3,(H,25,29)/t14-,16?,19?/m0/s1 |
| InChIKey | KBAAJOHYUYOXPN-ASFAAARLSA-N |
| XLogP | 0.18 |
| TPSA | 119.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.38 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|