C21H27ClN6O4 — CID 154826313
6-[4-[2-[(2S,5R)-5-[(5-chloro-6-oxodiazinan-4-yl)oxymethyl]oxolan-2-yl]acetyl]piperazin-1-yl]pyridine-3-carbonitrile (PubChem CID 154826313) has the molecular formula C21H27ClN6O4 and a molecular weight of 462.94 g/mol. Its IUPAC name is 6-[4-[2-[(2S,5R)-5-[(5-chloro-6-oxodiazinan-4-yl)oxymethyl]oxolan-2-yl]acetyl]piperazin-1-yl]pyridine-3-carbonitrile.
| Compound Name | 6-[4-[2-[(2S,5R)-5-[(5-chloro-6-oxodiazinan-4-yl)oxymethyl]oxolan-2-yl]acetyl]piperazin-1-yl]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 154826313 |
| Molecular Formula | C21H27ClN6O4 |
| Molecular Weight | 462.94 g/mol |
| Exact Mass | 462.18 |
| IUPAC Name | 6-[4-[2-[(2S,5R)-5-[(5-chloro-6-oxodiazinan-4-yl)oxymethyl]oxolan-2-yl]acetyl]piperazin-1-yl]pyridine-3-carbonitrile |
| SMILES | N#Cc1ccc(N2CCN(C(=O)C[C@@H]3CC[C@H](COC4CNNC(=O)C4Cl)O3)CC2)nc1 |
| InChI | InChI=1S/C21H27ClN6O4/c22-20-17(12-25-26-21(20)30)31-13-16-3-2-15(32-16)9-19(29)28-7-5-27(6-8-28)18-4-1-14(10-23)11-24-18/h1,4,11,15-17,20,25H,2-3,5-9,12-13H2,(H,26,30)/t15-,16+,17?,20?/m0/s1 |
| InChIKey | TZXUNWOCGKUIDP-RIGHFQGKSA-N |
| XLogP | 0.17 |
| TPSA | 119.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.94 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|