C20H25F3N6O4 — CID 154826192
6-[4-[2-[3-[6-oxo-5-(trifluoromethyl)diazinan-4-yl]oxypropoxy]acetyl]piperazin-1-yl]pyridine-3-carbonitrile (PubChem CID 154826192) has the molecular formula C20H25F3N6O4 and a molecular weight of 470.45 g/mol. Its IUPAC name is 6-[4-[2-[3-[6-oxo-5-(trifluoromethyl)diazinan-4-yl]oxypropoxy]acetyl]piperazin-1-yl]pyridine-3-carbonitrile.
| Compound Name | 6-[4-[2-[3-[6-oxo-5-(trifluoromethyl)diazinan-4-yl]oxypropoxy]acetyl]piperazin-1-yl]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 154826192 |
| Molecular Formula | C20H25F3N6O4 |
| Molecular Weight | 470.45 g/mol |
| Exact Mass | 470.19 |
| IUPAC Name | 6-[4-[2-[3-[6-oxo-5-(trifluoromethyl)diazinan-4-yl]oxypropoxy]acetyl]piperazin-1-yl]pyridine-3-carbonitrile |
| SMILES | N#Cc1ccc(N2CCN(C(=O)COCCCOC3CNNC(=O)C3C(F)(F)F)CC2)nc1 |
| InChI | InChI=1S/C20H25F3N6O4/c21-20(22,23)18-15(12-26-27-19(18)31)33-9-1-8-32-13-17(30)29-6-4-28(5-7-29)16-3-2-14(10-24)11-25-16/h2-3,11,15,18,26H,1,4-9,12-13H2,(H,27,31) |
| InChIKey | NVPJMWQEPTWAKK-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 119.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.45 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|