C18H24ClN7O4 — CID 154826248
5-[2-[3-[4-(5-chloropyrimidin-2-yl)piperazin-1-yl]-3-oxopropoxy]ethoxy]-3-oxodiazinane-4-carbonitrile (PubChem CID 154826248) has the molecular formula C18H24ClN7O4 and a molecular weight of 437.89 g/mol. Its IUPAC name is 5-[2-[3-[4-(5-chloropyrimidin-2-yl)piperazin-1-yl]-3-oxopropoxy]ethoxy]-3-oxodiazinane-4-carbonitrile.
| Compound Name | 5-[2-[3-[4-(5-chloropyrimidin-2-yl)piperazin-1-yl]-3-oxopropoxy]ethoxy]-3-oxodiazinane-4-carbonitrile |
|---|---|
| PubChem CID | 154826248 |
| Molecular Formula | C18H24ClN7O4 |
| Molecular Weight | 437.89 g/mol |
| Exact Mass | 437.16 |
| IUPAC Name | 5-[2-[3-[4-(5-chloropyrimidin-2-yl)piperazin-1-yl]-3-oxopropoxy]ethoxy]-3-oxodiazinane-4-carbonitrile |
| SMILES | N#CC1C(=O)NNCC1OCCOCCC(=O)N1CCN(c2ncc(Cl)cn2)CC1 |
| InChI | InChI=1S/C18H24ClN7O4/c19-13-10-21-18(22-11-13)26-4-2-25(3-5-26)16(27)1-6-29-7-8-30-15-12-23-24-17(28)14(15)9-20/h10-11,14-15,23H,1-8,12H2,(H,24,28) |
| InChIKey | RYJGOSMCMRGWRI-UHFFFAOYSA-N |
| XLogP | -0.66 |
| TPSA | 132.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.89 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|