C18H26Cl2N6O4 — CID 154826300
4-chloro-5-[(2S)-2-[3-[4-(5-chloropyrimidin-2-yl)piperazin-1-yl]-3-oxopropoxy]propoxy]diazinan-3-one (PubChem CID 154826300) has the molecular formula C18H26Cl2N6O4 and a molecular weight of 461.35 g/mol. Its IUPAC name is 4-chloro-5-[(2S)-2-[3-[4-(5-chloropyrimidin-2-yl)piperazin-1-yl]-3-oxopropoxy]propoxy]diazinan-3-one.
| Compound Name | 4-chloro-5-[(2S)-2-[3-[4-(5-chloropyrimidin-2-yl)piperazin-1-yl]-3-oxopropoxy]propoxy]diazinan-3-one |
|---|---|
| PubChem CID | 154826300 |
| Molecular Formula | C18H26Cl2N6O4 |
| Molecular Weight | 461.35 g/mol |
| Exact Mass | 460.14 |
| IUPAC Name | 4-chloro-5-[(2S)-2-[3-[4-(5-chloropyrimidin-2-yl)piperazin-1-yl]-3-oxopropoxy]propoxy]diazinan-3-one |
| SMILES | C[C@@H](COC1CNNC(=O)C1Cl)OCCC(=O)N1CCN(c2ncc(Cl)cn2)CC1 |
| InChI | InChI=1S/C18H26Cl2N6O4/c1-12(11-30-14-10-23-24-17(28)16(14)20)29-7-2-15(27)25-3-5-26(6-4-25)18-21-8-13(19)9-22-18/h8-9,12,14,16,23H,2-7,10-11H2,1H3,(H,24,28)/t12-,14?,16?/m0/s1 |
| InChIKey | YVJPTUXKYNCVRP-YGONEPDPSA-N |
| XLogP | 0.20 |
| TPSA | 108.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.35 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|