C22H24F3N5O3 — CID 165392604
4-[2-[3-oxo-3-[4-[5-(trifluoromethyl)pyrimidin-2-yl]piperazin-1-yl]propoxy]ethyl]-2,3-dihydroisoindol-1-one (PubChem CID 165392604) has the molecular formula C22H24F3N5O3 and a molecular weight of 463.46 g/mol. Its IUPAC name is 4-[2-[3-oxo-3-[4-[5-(trifluoromethyl)pyrimidin-2-yl]piperazin-1-yl]propoxy]ethyl]-2,3-dihydroisoindol-1-one.
| Compound Name | 4-[2-[3-oxo-3-[4-[5-(trifluoromethyl)pyrimidin-2-yl]piperazin-1-yl]propoxy]ethyl]-2,3-dihydroisoindol-1-one |
|---|---|
| PubChem CID | 165392604 |
| Molecular Formula | C22H24F3N5O3 |
| Molecular Weight | 463.46 g/mol |
| Exact Mass | 463.18 |
| IUPAC Name | 4-[2-[3-oxo-3-[4-[5-(trifluoromethyl)pyrimidin-2-yl]piperazin-1-yl]propoxy]ethyl]-2,3-dihydroisoindol-1-one |
| SMILES | O=C1NCc2c(CCOCCC(=O)N3CCN(c4ncc(C(F)(F)F)cn4)CC3)cccc21 |
| InChI | InChI=1S/C22H24F3N5O3/c23-22(24,25)16-12-27-21(28-13-16)30-8-6-29(7-9-30)19(31)5-11-33-10-4-15-2-1-3-17-18(15)14-26-20(17)32/h1-3,12-13H,4-11,14H2,(H,26,32) |
| InChIKey | UHJGVLFXQNUKSM-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.46 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|