C19H31N5O2 — CID 86924247
3-[4-(2-methoxyethyl)piperazin-1-yl]-1-(4-pyridin-2-ylpiperazin-1-yl)propan-1-one (PubChem CID 86924247) has the molecular formula C19H31N5O2 and a molecular weight of 361.49 g/mol. Its IUPAC name is 3-[4-(2-methoxyethyl)piperazin-1-yl]-1-(4-pyridin-2-ylpiperazin-1-yl)propan-1-one.
| Compound Name | 3-[4-(2-methoxyethyl)piperazin-1-yl]-1-(4-pyridin-2-ylpiperazin-1-yl)propan-1-one |
|---|---|
| PubChem CID | 86924247 |
| Molecular Formula | C19H31N5O2 |
| Molecular Weight | 361.49 g/mol |
| Exact Mass | 361.25 |
| IUPAC Name | 3-[4-(2-methoxyethyl)piperazin-1-yl]-1-(4-pyridin-2-ylpiperazin-1-yl)propan-1-one |
| SMILES | COCCN1CCN(CCC(=O)N2CCN(c3ccccn3)CC2)CC1 |
| InChI | InChI=1S/C19H31N5O2/c1-26-17-16-22-10-8-21(9-11-22)7-5-19(25)24-14-12-23(13-15-24)18-4-2-3-6-20-18/h2-4,6H,5,7-17H2,1H3 |
| InChIKey | NHBXKZSLWPSTEK-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 52.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.49 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |