C19H22ClN7O3 — CID 165392566
1-[2-[3-[4-(5-chloro-2-pyridinyl)piperazin-1-yl]-3-oxopropoxy]ethyl]-5H-pyrazolo[4,5-d]pyridazin-4-one (PubChem CID 165392566) has the molecular formula C19H22ClN7O3 and a molecular weight of 431.88 g/mol. Its IUPAC name is 1-[2-[3-[4-(5-chloro-2-pyridinyl)piperazin-1-yl]-3-oxopropoxy]ethyl]-5H-pyrazolo[4,5-d]pyridazin-4-one.
| Compound Name | 1-[2-[3-[4-(5-chloro-2-pyridinyl)piperazin-1-yl]-3-oxopropoxy]ethyl]-5H-pyrazolo[4,5-d]pyridazin-4-one |
|---|---|
| PubChem CID | 165392566 |
| Molecular Formula | C19H22ClN7O3 |
| Molecular Weight | 431.88 g/mol |
| Exact Mass | 431.15 |
| IUPAC Name | 1-[2-[3-[4-(5-chloro-2-pyridinyl)piperazin-1-yl]-3-oxopropoxy]ethyl]-5H-pyrazolo[4,5-d]pyridazin-4-one |
| SMILES | O=C(CCOCCn1ncc2c(=O)[nH]ncc21)N1CCN(c2ccc(Cl)cn2)CC1 |
| InChI | InChI=1S/C19H22ClN7O3/c20-14-1-2-17(21-11-14)25-4-6-26(7-5-25)18(28)3-9-30-10-8-27-16-13-22-24-19(29)15(16)12-23-27/h1-2,11-13H,3-10H2,(H,24,29) |
| InChIKey | LREZARGJVQUNEH-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 109.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.88 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|