C24H28F4N6O3 — CID 165392748
3-[2-fluoro-2-(1-oxo-2H-phthalazin-5-yl)propoxy]propanal;2-(4-methylpiperazin-1-yl)-5-(trifluoromethyl)pyrimidine (PubChem CID 165392748) has the molecular formula C24H28F4N6O3 and a molecular weight of 524.52 g/mol. Its IUPAC name is 3-[2-fluoro-2-(1-oxo-2H-phthalazin-5-yl)propoxy]propanal;2-(4-methylpiperazin-1-yl)-5-(trifluoromethyl)pyrimidine.
| Compound Name | 3-[2-fluoro-2-(1-oxo-2H-phthalazin-5-yl)propoxy]propanal;2-(4-methylpiperazin-1-yl)-5-(trifluoromethyl)pyrimidine |
|---|---|
| PubChem CID | 165392748 |
| Molecular Formula | C24H28F4N6O3 |
| Molecular Weight | 524.52 g/mol |
| Exact Mass | 524.22 |
| IUPAC Name | 3-[2-fluoro-2-(1-oxo-2H-phthalazin-5-yl)propoxy]propanal;2-(4-methylpiperazin-1-yl)-5-(trifluoromethyl)pyrimidine |
| SMILES | CC(F)(COCCC=O)c1cccc2c(=O)[nH]ncc12.CN1CCN(c2ncc(C(F)(F)F)cn2)CC1 |
| InChI | InChI=1S/C14H15FN2O3.C10H13F3N4/c1-14(15,9-20-7-3-6-18)12-5-2-4-10-11(12)8-16-17-13(10)19;1-16-2-4-17(5-3-16)9-14-6-8(7-15-9)10(11,12)13/h2,4-6,8H,3,7,9H2,1H3,(H,17,19);6-7H,2-5H2,1H3 |
| InChIKey | YWQGZYHYZSHTFH-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 104.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.52 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|