C18H23F3N6O5S — CID 152815057
5-methyl-4-[2-[2-[4-[5-(trifluoromethyl)pyrimidin-2-yl]piperazin-1-yl]sulfonylethoxy]ethoxy]-1H-pyridazin-6-one (PubChem CID 152815057) has the molecular formula C18H23F3N6O5S and a molecular weight of 492.48 g/mol. Its IUPAC name is 5-methyl-4-[2-[2-[4-[5-(trifluoromethyl)pyrimidin-2-yl]piperazin-1-yl]sulfonylethoxy]ethoxy]-1H-pyridazin-6-one.
| Compound Name | 5-methyl-4-[2-[2-[4-[5-(trifluoromethyl)pyrimidin-2-yl]piperazin-1-yl]sulfonylethoxy]ethoxy]-1H-pyridazin-6-one |
|---|---|
| PubChem CID | 152815057 |
| Molecular Formula | C18H23F3N6O5S |
| Molecular Weight | 492.48 g/mol |
| Exact Mass | 492.14 |
| IUPAC Name | 5-methyl-4-[2-[2-[4-[5-(trifluoromethyl)pyrimidin-2-yl]piperazin-1-yl]sulfonylethoxy]ethoxy]-1H-pyridazin-6-one |
| SMILES | Cc1c(OCCOCCS(=O)(=O)N2CCN(c3ncc(C(F)(F)F)cn3)CC2)cn[nH]c1=O |
| InChI | InChI=1S/C18H23F3N6O5S/c1-13-15(12-24-25-16(13)28)32-7-6-31-8-9-33(29,30)27-4-2-26(3-5-27)17-22-10-14(11-23-17)18(19,20)21/h10-12H,2-9H2,1H3,(H,25,28) |
| InChIKey | SSFBIOGMHJKUFY-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 130.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.48 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|