C11H9F3O — CID 123349767
1-buta-1,3-dien-2-yl-4-(trifluoromethoxy)benzene (PubChem CID 123349767) has the molecular formula C11H9F3O and a molecular weight of 214.19 g/mol. Its IUPAC name is 1-buta-1,3-dien-2-yl-4-(trifluoromethoxy)benzene.
| Compound Name | 1-buta-1,3-dien-2-yl-4-(trifluoromethoxy)benzene |
|---|---|
| PubChem CID | 123349767 |
| Molecular Formula | C11H9F3O |
| Molecular Weight | 214.19 g/mol |
| Exact Mass | 214.06 |
| IUPAC Name | 1-buta-1,3-dien-2-yl-4-(trifluoromethoxy)benzene |
| SMILES | C=CC(=C)c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C11H9F3O/c1-3-8(2)9-4-6-10(7-5-9)15-11(12,13)14/h3-7H,1-2H2 |
| InChIKey | FXAGLSRBRGPUKF-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.19 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|