C19H17F3O2 — CID 134080745
4-[3-methyl-2-[4-(trifluoromethyl)phenyl]but-3-en-2-yl]benzoic acid (PubChem CID 134080745) has the molecular formula C19H17F3O2 and a molecular weight of 334.34 g/mol. Its IUPAC name is 4-[3-methyl-2-[4-(trifluoromethyl)phenyl]but-3-en-2-yl]benzoic acid.
| Compound Name | 4-[3-methyl-2-[4-(trifluoromethyl)phenyl]but-3-en-2-yl]benzoic acid |
|---|---|
| PubChem CID | 134080745 |
| Molecular Formula | C19H17F3O2 |
| Molecular Weight | 334.34 g/mol |
| Exact Mass | 334.12 |
| IUPAC Name | 4-[3-methyl-2-[4-(trifluoromethyl)phenyl]but-3-en-2-yl]benzoic acid |
| SMILES | C=C(C)C(C)(c1ccc(C(=O)O)cc1)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C19H17F3O2/c1-12(2)18(3,14-6-4-13(5-7-14)17(23)24)15-8-10-16(11-9-15)19(20,21)22/h4-11H,1H2,2-3H3,(H,23,24) |
| InChIKey | LFKHKUMFTLOPKA-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.34 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|