C22H16F6O4 — CID 146396186
(2E,4E)-2,5-dimethyl-3,4-bis[4-(trifluoromethyl)phenyl]hexa-2,4-dienedioic acid (PubChem CID 146396186) has the molecular formula C22H16F6O4 and a molecular weight of 458.35 g/mol. Its IUPAC name is (2E,4E)-2,5-dimethyl-3,4-bis[4-(trifluoromethyl)phenyl]hexa-2,4-dienedioic acid.
| Compound Name | (2E,4E)-2,5-dimethyl-3,4-bis[4-(trifluoromethyl)phenyl]hexa-2,4-dienedioic acid |
|---|---|
| PubChem CID | 146396186 |
| Molecular Formula | C22H16F6O4 |
| Molecular Weight | 458.35 g/mol |
| Exact Mass | 458.10 |
| IUPAC Name | (2E,4E)-2,5-dimethyl-3,4-bis[4-(trifluoromethyl)phenyl]hexa-2,4-dienedioic acid |
| SMILES | C/C(C(=O)O)=C(C(=C(/C)C(=O)O)\c1ccc(C(F)(F)F)cc1)/c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C22H16F6O4/c1-11(19(29)30)17(13-3-7-15(8-4-13)21(23,24)25)18(12(2)20(31)32)14-5-9-16(10-6-14)22(26,27)28/h3-10H,1-2H3,(H,29,30)(H,31,32)/b17-11+,18-12+ |
| InChIKey | IRPYYFMZIFPDBB-JYFOCSDGSA-N |
| XLogP | 6.14 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.35 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|