About (E)-4,4-dimethyl-3-[4-(trifluoromethyl)phenyl]pent-2-enoic acid
(E)-4,4-dimethyl-3-[4-(trifluoromethyl)phenyl]pent-2-enoic acid (PubChem CID 82093337) has the molecular formula C14H15F3O2
and a molecular weight of 272.27 g/mol. Its IUPAC name is (E)-4,4-dimethyl-3-[4-(trifluoromethyl)phenyl]pent-2-enoic acid.
Molecular Properties
| Compound Name | (E)-4,4-dimethyl-3-[4-(trifluoromethyl)phenyl]pent-2-enoic acid |
| PubChem CID | 82093337 |
| Molecular Formula | C14H15F3O2 |
| Molecular Weight | 272.27 g/mol |
| Exact Mass | 272.10 |
| IUPAC Name | (E)-4,4-dimethyl-3-[4-(trifluoromethyl)phenyl]pent-2-enoic acid |
| SMILES | CC(C)(C)/C(=C\C(=O)O)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C14H15F3O2/c1-13(2,3)11(8-12(18)19)9-4-6-10(7-5-9)14(15,16)17/h4-8H,1-3H3,(H,18,19)/b11-8- |
| InChIKey | LSXMHHCSZUABJV-FLIBITNWSA-N |
| XLogP | 4.22 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.27 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-4,4-dimethyl-3-[4-(trifluoromethyl)phenyl]pent-2-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-4,4-dimethyl-3-[4-(trifluoromethyl)phenyl]pent-2-enoic acid?
The IUPAC name of (E)-4,4-dimethyl-3-[4-(trifluoromethyl)phenyl]pent-2-enoic acid (CID 82093337) is (E)-4,4-dimethyl-3-[4-(trifluoromethyl)phenyl]pent-2-enoic acid.
What is the SMILES notation for (E)-4,4-dimethyl-3-[4-(trifluoromethyl)phenyl]pent-2-enoic acid?
The canonical SMILES for (E)-4,4-dimethyl-3-[4-(trifluoromethyl)phenyl]pent-2-enoic acid is CC(C)(C)/C(=C\C(=O)O)c1ccc(C(F)(F)F)cc1.
What is the InChIKey of (E)-4,4-dimethyl-3-[4-(trifluoromethyl)phenyl]pent-2-enoic acid?
The InChIKey is LSXMHHCSZUABJV-FLIBITNWSA-N. The full InChI is InChI=1S/C14H15F3O2/c1-13(2,3)11(8-12(18)19)9-4-6-10(7-5-9)14(15,16)17/h4-8H,1-3H3,(H,18,19)/b11-8-.
What are the key properties of (E)-4,4-dimethyl-3-[4-(trifluoromethyl)phenyl]pent-2-enoic acid?
(E)-4,4-dimethyl-3-[4-(trifluoromethyl)phenyl]pent-2-enoic acid has a molecular weight of 272.27 g/mol, XLogP of 4.22, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-4,4-dimethyl-3-[4-(trifluoromethyl)phenyl]pent-2-enoic acid is sourced from PubChem (CID 82093337), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).