C11H6F6O2 — CID 26596819
(Z)-1,1,1-trifluoro-4-hydroxy-4-[4-(trifluoromethyl)phenyl]but-3-en-2-one (PubChem CID 26596819) has the molecular formula C11H6F6O2 and a molecular weight of 284.16 g/mol. Its IUPAC name is (Z)-1,1,1-trifluoro-4-hydroxy-4-[4-(trifluoromethyl)phenyl]but-3-en-2-one.
| Compound Name | (Z)-1,1,1-trifluoro-4-hydroxy-4-[4-(trifluoromethyl)phenyl]but-3-en-2-one |
|---|---|
| PubChem CID | 26596819 |
| Molecular Formula | C11H6F6O2 |
| Molecular Weight | 284.16 g/mol |
| Exact Mass | 284.03 |
| IUPAC Name | (Z)-1,1,1-trifluoro-4-hydroxy-4-[4-(trifluoromethyl)phenyl]but-3-en-2-one |
| SMILES | O=C(/C=C(\O)c1ccc(C(F)(F)F)cc1)C(F)(F)F |
| InChI | InChI=1S/C11H6F6O2/c12-10(13,14)7-3-1-6(2-4-7)8(18)5-9(19)11(15,16)17/h1-5,18H/b8-5- |
| InChIKey | BWDIEXIIVZHWQP-YVMONPNESA-N |
| XLogP | 3.74 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.16 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|