C9H5ClF3NO2 — CID 25258346
(Z)-4-(2-chloro-4-pyridinyl)-1,1,1-trifluoro-4-hydroxybut-3-en-2-one (PubChem CID 25258346) has the molecular formula C9H5ClF3NO2 and a molecular weight of 251.59 g/mol. Its IUPAC name is (Z)-4-(2-chloro-4-pyridinyl)-1,1,1-trifluoro-4-hydroxybut-3-en-2-one.
| Compound Name | (Z)-4-(2-chloro-4-pyridinyl)-1,1,1-trifluoro-4-hydroxybut-3-en-2-one |
|---|---|
| PubChem CID | 25258346 |
| Molecular Formula | C9H5ClF3NO2 |
| Molecular Weight | 251.59 g/mol |
| Exact Mass | 251.00 |
| IUPAC Name | (Z)-4-(2-chloro-4-pyridinyl)-1,1,1-trifluoro-4-hydroxybut-3-en-2-one |
| SMILES | O=C(/C=C(\O)c1ccnc(Cl)c1)C(F)(F)F |
| InChI | InChI=1S/C9H5ClF3NO2/c10-8-3-5(1-2-14-8)6(15)4-7(16)9(11,12)13/h1-4,15H/b6-4- |
| InChIKey | SKEUEUIYQXPWER-XQRVVYSFSA-N |
| XLogP | 2.77 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.59 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|