C17H13F3O2 — CID 67503108
1,1,1-trifluoro-4-hydroxy-4-[4-(4-methylphenyl)phenyl]but-3-en-2-one (PubChem CID 67503108) has the molecular formula C17H13F3O2 and a molecular weight of 306.28 g/mol. Its IUPAC name is 1,1,1-trifluoro-4-hydroxy-4-[4-(4-methylphenyl)phenyl]but-3-en-2-one.
| Compound Name | 1,1,1-trifluoro-4-hydroxy-4-[4-(4-methylphenyl)phenyl]but-3-en-2-one |
|---|---|
| PubChem CID | 67503108 |
| Molecular Formula | C17H13F3O2 |
| Molecular Weight | 306.28 g/mol |
| Exact Mass | 306.09 |
| IUPAC Name | 1,1,1-trifluoro-4-hydroxy-4-[4-(4-methylphenyl)phenyl]but-3-en-2-one |
| SMILES | Cc1ccc(-c2ccc(C(O)=CC(=O)C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C17H13F3O2/c1-11-2-4-12(5-3-11)13-6-8-14(9-7-13)15(21)10-16(22)17(18,19)20/h2-10,21H,1H3 |
| InChIKey | WHSORVWQKLBMRA-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.28 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|