C18H16O3 — CID 884327
4-hydroxy-1,4-bis(4-methylphenyl)but-3-ene-1,2-dione (PubChem CID 884327) has the molecular formula C18H16O3 and a molecular weight of 280.32 g/mol. Its IUPAC name is 4-hydroxy-1,4-bis(4-methylphenyl)but-3-ene-1,2-dione.
| Compound Name | 4-hydroxy-1,4-bis(4-methylphenyl)but-3-ene-1,2-dione |
|---|---|
| PubChem CID | 884327 |
| Molecular Formula | C18H16O3 |
| Molecular Weight | 280.32 g/mol |
| Exact Mass | 280.11 |
| IUPAC Name | 4-hydroxy-1,4-bis(4-methylphenyl)but-3-ene-1,2-dione |
| SMILES | Cc1ccc(C(=O)C(=O)C=C(O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C18H16O3/c1-12-3-7-14(8-4-12)16(19)11-17(20)18(21)15-9-5-13(2)6-10-15/h3-11,19H,1-2H3 |
| InChIKey | IYMIXMDPPDKDCY-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.32 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|