C15H14N2O4 — CID 91962863
(Z)-4-hydroxy-N-(5-methyl-1,2-oxazol-3-yl)-4-(4-methylphenyl)-2-oxobut-3-enamide (PubChem CID 91962863) has the molecular formula C15H14N2O4 and a molecular weight of 286.29 g/mol. Its IUPAC name is (Z)-4-hydroxy-N-(5-methyl-1,2-oxazol-3-yl)-4-(4-methylphenyl)-2-oxobut-3-enamide.
| Compound Name | (Z)-4-hydroxy-N-(5-methyl-1,2-oxazol-3-yl)-4-(4-methylphenyl)-2-oxobut-3-enamide |
|---|---|
| PubChem CID | 91962863 |
| Molecular Formula | C15H14N2O4 |
| Molecular Weight | 286.29 g/mol |
| Exact Mass | 286.10 |
| IUPAC Name | (Z)-4-hydroxy-N-(5-methyl-1,2-oxazol-3-yl)-4-(4-methylphenyl)-2-oxobut-3-enamide |
| SMILES | Cc1ccc(/C(O)=C/C(=O)C(=O)Nc2cc(C)on2)cc1 |
| InChI | InChI=1S/C15H14N2O4/c1-9-3-5-11(6-4-9)12(18)8-13(19)15(20)16-14-7-10(2)21-17-14/h3-8,18H,1-2H3,(H,16,17,20)/b12-8- |
| InChIKey | YIOSKHFEVFRGGP-WQLSENKSSA-N |
| XLogP | 2.40 |
| TPSA | 92.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.29 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|