C12H13N3O2 — CID 62165645
4-(methylamino)-N-(5-methyl-1,2-oxazol-3-yl)benzamide (PubChem CID 62165645) has the molecular formula C12H13N3O2 and a molecular weight of 231.25 g/mol. Its IUPAC name is 4-(methylamino)-N-(5-methyl-1,2-oxazol-3-yl)benzamide.
| Compound Name | 4-(methylamino)-N-(5-methyl-1,2-oxazol-3-yl)benzamide |
|---|---|
| PubChem CID | 62165645 |
| Molecular Formula | C12H13N3O2 |
| Molecular Weight | 231.25 g/mol |
| Exact Mass | 231.10 |
| IUPAC Name | 4-(methylamino)-N-(5-methyl-1,2-oxazol-3-yl)benzamide |
| SMILES | CNc1ccc(C(=O)Nc2cc(C)on2)cc1 |
| InChI | InChI=1S/C12H13N3O2/c1-8-7-11(15-17-8)14-12(16)9-3-5-10(13-2)6-4-9/h3-7,13H,1-2H3,(H,14,15,16) |
| InChIKey | CXNSLILUZAIRGW-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.25 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |