C18H12F6O2 — CID 141194647
2-methyl-3,3-bis[4-(trifluoromethyl)phenyl]prop-2-enoic acid (PubChem CID 141194647) has the molecular formula C18H12F6O2 and a molecular weight of 374.28 g/mol. Its IUPAC name is 2-methyl-3,3-bis[4-(trifluoromethyl)phenyl]prop-2-enoic acid.
| Compound Name | 2-methyl-3,3-bis[4-(trifluoromethyl)phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 141194647 |
| Molecular Formula | C18H12F6O2 |
| Molecular Weight | 374.28 g/mol |
| Exact Mass | 374.07 |
| IUPAC Name | 2-methyl-3,3-bis[4-(trifluoromethyl)phenyl]prop-2-enoic acid |
| SMILES | CC(C(=O)O)=C(c1ccc(C(F)(F)F)cc1)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C18H12F6O2/c1-10(16(25)26)15(11-2-6-13(7-3-11)17(19,20)21)12-4-8-14(9-5-12)18(22,23)24/h2-9H,1H3,(H,25,26) |
| InChIKey | MSWFWORQCYQHLC-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.28 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|