C10H11F3N2O2 — CID 67344222
acetic acid;4-(trifluoromethyl)benzenecarboximidamide (PubChem CID 67344222) has the molecular formula C10H11F3N2O2 and a molecular weight of 248.20 g/mol. Its IUPAC name is acetic acid;4-(trifluoromethyl)benzenecarboximidamide.
| Compound Name | acetic acid;4-(trifluoromethyl)benzenecarboximidamide |
|---|---|
| PubChem CID | 67344222 |
| Molecular Formula | C10H11F3N2O2 |
| Molecular Weight | 248.20 g/mol |
| Exact Mass | 248.08 |
| IUPAC Name | acetic acid;4-(trifluoromethyl)benzenecarboximidamide |
| SMILES | CC(=O)O.[H]/N=C(\N)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C8H7F3N2.C2H4O2/c9-8(10,11)6-3-1-5(2-4-6)7(12)13;1-2(3)4/h1-4H,(H3,12,13);1H3,(H,3,4) |
| InChIKey | FYYLZOKGOFWYEB-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 87.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.20 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|