C15H10F6N2 — CID 34178690
4-[3,5-bis(trifluoromethyl)phenyl]benzenecarboximidamide (PubChem CID 34178690) has the molecular formula C15H10F6N2 and a molecular weight of 332.25 g/mol. Its IUPAC name is 4-[3,5-bis(trifluoromethyl)phenyl]benzenecarboximidamide.
| Compound Name | 4-[3,5-bis(trifluoromethyl)phenyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 34178690 |
| Molecular Formula | C15H10F6N2 |
| Molecular Weight | 332.25 g/mol |
| Exact Mass | 332.07 |
| IUPAC Name | 4-[3,5-bis(trifluoromethyl)phenyl]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(-c2cc(C(F)(F)F)cc(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C15H10F6N2/c16-14(17,18)11-5-10(6-12(7-11)15(19,20)21)8-1-3-9(4-2-8)13(22)23/h1-7H,(H3,22,23) |
| InChIKey | ZKFKMIMWRGYSPM-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.25 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|