C13H10F2N2 — CID 15114042
4-(3,4-difluorophenyl)benzenecarboximidamide (PubChem CID 15114042) has the molecular formula C13H10F2N2 and a molecular weight of 232.23 g/mol. Its IUPAC name is 4-(3,4-difluorophenyl)benzenecarboximidamide.
| Compound Name | 4-(3,4-difluorophenyl)benzenecarboximidamide |
|---|---|
| PubChem CID | 15114042 |
| Molecular Formula | C13H10F2N2 |
| Molecular Weight | 232.23 g/mol |
| Exact Mass | 232.08 |
| IUPAC Name | 4-(3,4-difluorophenyl)benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(-c2ccc(F)c(F)c2)cc1 |
| InChI | InChI=1S/C13H10F2N2/c14-11-6-5-10(7-12(11)15)8-1-3-9(4-2-8)13(16)17/h1-7H,(H3,16,17) |
| InChIKey | RMTVFXOTMXYQFT-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.23 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|