C13H8F4N2S — CID 81294523
4-(3,4-difluorophenyl)sulfanyl-3,5-difluorobenzenecarboximidamide (PubChem CID 81294523) has the molecular formula C13H8F4N2S and a molecular weight of 300.28 g/mol. Its IUPAC name is 4-(3,4-difluorophenyl)sulfanyl-3,5-difluorobenzenecarboximidamide.
| Compound Name | 4-(3,4-difluorophenyl)sulfanyl-3,5-difluorobenzenecarboximidamide |
|---|---|
| PubChem CID | 81294523 |
| Molecular Formula | C13H8F4N2S |
| Molecular Weight | 300.28 g/mol |
| Exact Mass | 300.03 |
| IUPAC Name | 4-(3,4-difluorophenyl)sulfanyl-3,5-difluorobenzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1cc(F)c(Sc2ccc(F)c(F)c2)c(F)c1 |
| InChI | InChI=1S/C13H8F4N2S/c14-8-2-1-7(5-9(8)15)20-12-10(16)3-6(13(18)19)4-11(12)17/h1-5H,(H3,18,19) |
| InChIKey | RDIGWZMIVYWSPQ-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.28 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|