C11H8F2N4S — CID 80515913
3-(3,4-difluorophenyl)sulfanylpyridazine-4-carboximidamide (PubChem CID 80515913) has the molecular formula C11H8F2N4S and a molecular weight of 266.28 g/mol. Its IUPAC name is 3-(3,4-difluorophenyl)sulfanylpyridazine-4-carboximidamide.
| Compound Name | 3-(3,4-difluorophenyl)sulfanylpyridazine-4-carboximidamide |
|---|---|
| PubChem CID | 80515913 |
| Molecular Formula | C11H8F2N4S |
| Molecular Weight | 266.28 g/mol |
| Exact Mass | 266.04 |
| IUPAC Name | 3-(3,4-difluorophenyl)sulfanylpyridazine-4-carboximidamide |
| SMILES | [H]/N=C(\N)c1ccnnc1Sc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C11H8F2N4S/c12-8-2-1-6(5-9(8)13)18-11-7(10(14)15)3-4-16-17-11/h1-5H,(H3,14,15) |
| InChIKey | FOKNPUBHPYFJRN-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 75.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.28 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|