C13H5F4NS — CID 81283065
4-(3,4-difluorophenyl)sulfanyl-3,5-difluorobenzonitrile (PubChem CID 81283065) has the molecular formula C13H5F4NS and a molecular weight of 283.25 g/mol. Its IUPAC name is 4-(3,4-difluorophenyl)sulfanyl-3,5-difluorobenzonitrile.
| Compound Name | 4-(3,4-difluorophenyl)sulfanyl-3,5-difluorobenzonitrile |
|---|---|
| PubChem CID | 81283065 |
| Molecular Formula | C13H5F4NS |
| Molecular Weight | 283.25 g/mol |
| Exact Mass | 283.01 |
| IUPAC Name | 4-(3,4-difluorophenyl)sulfanyl-3,5-difluorobenzonitrile |
| SMILES | N#Cc1cc(F)c(Sc2ccc(F)c(F)c2)c(F)c1 |
| InChI | InChI=1S/C13H5F4NS/c14-9-2-1-8(5-10(9)15)19-13-11(16)3-7(6-18)4-12(13)17/h1-5H |
| InChIKey | ZJTYWPZILALYIP-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.25 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |