C12H10F2N2S — CID 106748746
4-(3,4-difluorophenyl)sulfanylbenzene-1,2-diamine (PubChem CID 106748746) has the molecular formula C12H10F2N2S and a molecular weight of 252.29 g/mol. Its IUPAC name is 4-(3,4-difluorophenyl)sulfanylbenzene-1,2-diamine.
| Compound Name | 4-(3,4-difluorophenyl)sulfanylbenzene-1,2-diamine |
|---|---|
| PubChem CID | 106748746 |
| Molecular Formula | C12H10F2N2S |
| Molecular Weight | 252.29 g/mol |
| Exact Mass | 252.05 |
| IUPAC Name | 4-(3,4-difluorophenyl)sulfanylbenzene-1,2-diamine |
| SMILES | Nc1ccc(Sc2ccc(F)c(F)c2)cc1N |
| InChI | InChI=1S/C12H10F2N2S/c13-9-3-1-7(5-10(9)14)17-8-2-4-11(15)12(16)6-8/h1-6H,15-16H2 |
| InChIKey | UKLXQNLMZLDUJO-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.29 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|