C12H13N3S — CID 10130826
4-(4-aminophenyl)sulfanylbenzene-1,2-diamine (PubChem CID 10130826) has the molecular formula C12H13N3S and a molecular weight of 231.32 g/mol. Its IUPAC name is 4-(4-aminophenyl)sulfanylbenzene-1,2-diamine.
| Compound Name | 4-(4-aminophenyl)sulfanylbenzene-1,2-diamine |
|---|---|
| PubChem CID | 10130826 |
| Molecular Formula | C12H13N3S |
| Molecular Weight | 231.32 g/mol |
| Exact Mass | 231.08 |
| IUPAC Name | 4-(4-aminophenyl)sulfanylbenzene-1,2-diamine |
| SMILES | Nc1ccc(Sc2ccc(N)c(N)c2)cc1 |
| InChI | InChI=1S/C12H13N3S/c13-8-1-3-9(4-2-8)16-10-5-6-11(14)12(15)7-10/h1-7H,13-15H2 |
| InChIKey | AUTXJLFNORABNE-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 78.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.32 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|