About 4-(4-aminophenyl)sulfanylaniline;pentahydrofluoride
4-(4-aminophenyl)sulfanylaniline;pentahydrofluoride (PubChem CID 172767370) has the molecular formula C12H17F5N2S
and a molecular weight of 316.34 g/mol. Its IUPAC name is 4-(4-aminophenyl)sulfanylaniline;pentahydrofluoride.
Molecular Properties
| Compound Name | 4-(4-aminophenyl)sulfanylaniline;pentahydrofluoride |
| PubChem CID | 172767370 |
| Molecular Formula | C12H17F5N2S |
| Molecular Weight | 316.34 g/mol |
| Exact Mass | 316.10 |
| IUPAC Name | 4-(4-aminophenyl)sulfanylaniline;pentahydrofluoride |
| SMILES | F.F.F.F.F.Nc1ccc(Sc2ccc(N)cc2)cc1 |
| InChI | InChI=1S/C12H12N2S.5FH/c13-9-1-5-11(6-2-9)15-12-7-3-10(14)4-8-12;;;;;/h1-8H,13-14H2;5*1H |
| InChIKey | MMMKMLIJKZOLAF-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.34 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-(4-aminophenyl)sulfanylaniline;pentahydrofluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-aminophenyl)sulfanylaniline;pentahydrofluoride?
The IUPAC name of 4-(4-aminophenyl)sulfanylaniline;pentahydrofluoride (CID 172767370) is 4-(4-aminophenyl)sulfanylaniline;pentahydrofluoride.
What is the SMILES notation for 4-(4-aminophenyl)sulfanylaniline;pentahydrofluoride?
The canonical SMILES for 4-(4-aminophenyl)sulfanylaniline;pentahydrofluoride is F.F.F.F.F.Nc1ccc(Sc2ccc(N)cc2)cc1.
What is the InChIKey of 4-(4-aminophenyl)sulfanylaniline;pentahydrofluoride?
The InChIKey is MMMKMLIJKZOLAF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12N2S.5FH/c13-9-1-5-11(6-2-9)15-12-7-3-10(14)4-8-12;;;;;/h1-8H,13-14H2;5*1H.
What are the key properties of 4-(4-aminophenyl)sulfanylaniline;pentahydrofluoride?
4-(4-aminophenyl)sulfanylaniline;pentahydrofluoride has a molecular weight of 316.34 g/mol, XLogP of 3.76, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-aminophenyl)sulfanylaniline;pentahydrofluoride is sourced from PubChem (CID 172767370), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).