About 4,4'-Thiodianiline
4,4'-Thiodianiline (PubChem CID 8765) has the molecular formula C12H12N2S
and a molecular weight of 216.30 g/mol. Its IUPAC name is 4-(4-aminophenyl)sulfanylaniline.
Molecular Properties
| Compound Name | 4,4'-Thiodianiline |
| PubChem CID | 8765 |
| Molecular Formula | C12H12N2S |
| Molecular Weight | 216.30 g/mol |
| Exact Mass | 216.07 |
| IUPAC Name | 4-(4-aminophenyl)sulfanylaniline |
| SMILES | C1=CC(=CC=C1N)SC2=CC=C(C=C2)N |
| InChI | InChI=1S/C12H12N2S/c13-9-1-5-11(6-2-9)15-12-7-3-10(14)4-8-12/h1-8H,13-14H2 |
| InChIKey | ICNFHJVPAJKPHW-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 77.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | 162 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.30 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4,4'-Thiodianiline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,4'-Thiodianiline?
The IUPAC name of 4,4'-Thiodianiline (CID 8765) is 4-(4-aminophenyl)sulfanylaniline.
What is the SMILES notation for 4,4'-Thiodianiline?
The canonical SMILES for 4,4'-Thiodianiline is C1=CC(=CC=C1N)SC2=CC=C(C=C2)N.
What is the InChIKey of 4,4'-Thiodianiline?
The InChIKey is ICNFHJVPAJKPHW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12N2S/c13-9-1-5-11(6-2-9)15-12-7-3-10(14)4-8-12/h1-8H,13-14H2.
What are the key properties of 4,4'-Thiodianiline?
4,4'-Thiodianiline has a molecular weight of 216.30 g/mol, XLogP of 2.20, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4,4'-Thiodianiline is sourced from PubChem (CID 8765), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).