About 3,3'-Sulphonyldianiline
3,3'-Sulphonyldianiline (PubChem CID 11741) has the molecular formula C12H12N2O2S
and a molecular weight of 248.30 g/mol. Its IUPAC name is 3-(3-aminophenyl)sulfonylaniline.
Molecular Properties
| Compound Name | 3,3'-Sulphonyldianiline |
| PubChem CID | 11741 |
| Molecular Formula | C12H12N2O2S |
| Molecular Weight | 248.30 g/mol |
| Exact Mass | 248.06 |
| IUPAC Name | 3-(3-aminophenyl)sulfonylaniline |
| SMILES | C1=CC(=CC(=C1)S(=O)(=O)C2=CC=CC(=C2)N)N |
| InChI | InChI=1S/C12H12N2O2S/c13-9-3-1-5-11(7-9)17(15,16)12-6-2-4-10(14)8-12/h1-8H,13-14H2 |
| InChIKey | LJGHYPLBDBRCRZ-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 94.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | 322 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.30 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3,3'-Sulphonyldianiline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3'-Sulphonyldianiline?
The IUPAC name of 3,3'-Sulphonyldianiline (CID 11741) is 3-(3-aminophenyl)sulfonylaniline.
What is the SMILES notation for 3,3'-Sulphonyldianiline?
The canonical SMILES for 3,3'-Sulphonyldianiline is C1=CC(=CC(=C1)S(=O)(=O)C2=CC=CC(=C2)N)N.
What is the InChIKey of 3,3'-Sulphonyldianiline?
The InChIKey is LJGHYPLBDBRCRZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12N2O2S/c13-9-3-1-5-11(7-9)17(15,16)12-6-2-4-10(14)8-12/h1-8H,13-14H2.
What are the key properties of 3,3'-Sulphonyldianiline?
3,3'-Sulphonyldianiline has a molecular weight of 248.30 g/mol, XLogP of 1.00, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3'-Sulphonyldianiline is sourced from PubChem (CID 11741), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).