About Sulfabenz
Sulfabenz (PubChem CID 31390) has the molecular formula C12H12N2O2S
and a molecular weight of 248.30 g/mol. Its IUPAC name is 4-amino-N-phenylbenzenesulfonamide.
Molecular Properties
| Compound Name | Sulfabenz |
| PubChem CID | 31390 |
| Molecular Formula | C12H12N2O2S |
| Molecular Weight | 248.30 g/mol |
| Exact Mass | 248.06 |
| IUPAC Name | 4-amino-N-phenylbenzenesulfonamide |
| SMILES | C1=CC=C(C=C1)NS(=O)(=O)C2=CC=C(C=C2)N |
| InChI | InChI=1S/C12H12N2O2S/c13-10-6-8-12(9-7-10)17(15,16)14-11-4-2-1-3-5-11/h1-9,14H,13H2 |
| InChIKey | YBUXKQSCKVQATK-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 80.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | 323 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.30 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze Sulfabenz with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Sulfabenz?
The IUPAC name of Sulfabenz (CID 31390) is 4-amino-N-phenylbenzenesulfonamide.
What is the SMILES notation for Sulfabenz?
The canonical SMILES for Sulfabenz is C1=CC=C(C=C1)NS(=O)(=O)C2=CC=C(C=C2)N.
What is the InChIKey of Sulfabenz?
The InChIKey is YBUXKQSCKVQATK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12N2O2S/c13-10-6-8-12(9-7-10)17(15,16)14-11-4-2-1-3-5-11/h1-9,14H,13H2.
What are the key properties of Sulfabenz?
Sulfabenz has a molecular weight of 248.30 g/mol, XLogP of 1.60, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for Sulfabenz is sourced from PubChem (CID 31390), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).