About Sulfanilic acid
Sulfanilic acid (PubChem CID 8479) has the molecular formula C6H7NO3S
and a molecular weight of 173.19 g/mol. Its IUPAC name is 4-aminobenzenesulfonic acid.
Molecular Properties
| Compound Name | Sulfanilic acid |
| PubChem CID | 8479 |
| Molecular Formula | C6H7NO3S |
| Molecular Weight | 173.19 g/mol |
| Exact Mass | 173.01 |
| IUPAC Name | 4-aminobenzenesulfonic acid |
| SMILES | C1=CC(=CC=C1N)S(=O)(=O)O |
| InChI | InChI=1S/C6H7NO3S/c7-5-1-3-6(4-2-5)11(8,9)10/h1-4H,7H2,(H,8,9,10) |
| InChIKey | HVBSAKJJOYLTQU-UHFFFAOYSA-N |
| XLogP | -0.60 |
| TPSA | 88.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | 210 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.19 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze Sulfanilic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Sulfanilic acid?
The IUPAC name of Sulfanilic acid (CID 8479) is 4-aminobenzenesulfonic acid.
What is the SMILES notation for Sulfanilic acid?
The canonical SMILES for Sulfanilic acid is C1=CC(=CC=C1N)S(=O)(=O)O.
What is the InChIKey of Sulfanilic acid?
The InChIKey is HVBSAKJJOYLTQU-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7NO3S/c7-5-1-3-6(4-2-5)11(8,9)10/h1-4H,7H2,(H,8,9,10).
What are the key properties of Sulfanilic acid?
Sulfanilic acid has a molecular weight of 173.19 g/mol, XLogP of -0.60, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for Sulfanilic acid is sourced from PubChem (CID 8479), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).