C12H13N3O2S2 — CID 70370207
3-(3,4-diaminophenyl)sulfanylbenzenesulfonamide (PubChem CID 70370207) has the molecular formula C12H13N3O2S2 and a molecular weight of 295.39 g/mol. Its IUPAC name is 3-(3,4-diaminophenyl)sulfanylbenzenesulfonamide.
| Compound Name | 3-(3,4-diaminophenyl)sulfanylbenzenesulfonamide |
|---|---|
| PubChem CID | 70370207 |
| Molecular Formula | C12H13N3O2S2 |
| Molecular Weight | 295.39 g/mol |
| Exact Mass | 295.04 |
| IUPAC Name | 3-(3,4-diaminophenyl)sulfanylbenzenesulfonamide |
| SMILES | Nc1ccc(Sc2cccc(S(N)(=O)=O)c2)cc1N |
| InChI | InChI=1S/C12H13N3O2S2/c13-11-5-4-9(7-12(11)14)18-8-2-1-3-10(6-8)19(15,16)17/h1-7H,13-14H2,(H2,15,16,17) |
| InChIKey | GORINANBMCWGCJ-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 112.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.39 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|