C11H8F2N2S — CID 43345149
6-(3,4-difluorophenyl)sulfanylpyridin-3-amine (PubChem CID 43345149) has the molecular formula C11H8F2N2S and a molecular weight of 238.26 g/mol. Its IUPAC name is 6-(3,4-difluorophenyl)sulfanylpyridin-3-amine.
| Compound Name | 6-(3,4-difluorophenyl)sulfanylpyridin-3-amine |
|---|---|
| PubChem CID | 43345149 |
| Molecular Formula | C11H8F2N2S |
| Molecular Weight | 238.26 g/mol |
| Exact Mass | 238.04 |
| IUPAC Name | 6-(3,4-difluorophenyl)sulfanylpyridin-3-amine |
| SMILES | Nc1ccc(Sc2ccc(F)c(F)c2)nc1 |
| InChI | InChI=1S/C11H8F2N2S/c12-9-3-2-8(5-10(9)13)16-11-4-1-7(14)6-15-11/h1-6H,14H2 |
| InChIKey | GKKGVJDGVKFTIZ-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.26 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |