C11H5Cl5N2S — CID 56697110
6-(2,3,4,5,6-pentachlorophenyl)sulfanylpyridin-3-amine (PubChem CID 56697110) has the molecular formula C11H5Cl5N2S and a molecular weight of 374.51 g/mol. Its IUPAC name is 6-(2,3,4,5,6-pentachlorophenyl)sulfanylpyridin-3-amine.
| Compound Name | 6-(2,3,4,5,6-pentachlorophenyl)sulfanylpyridin-3-amine |
|---|---|
| PubChem CID | 56697110 |
| Molecular Formula | C11H5Cl5N2S |
| Molecular Weight | 374.51 g/mol |
| Exact Mass | 371.86 |
| IUPAC Name | 6-(2,3,4,5,6-pentachlorophenyl)sulfanylpyridin-3-amine |
| SMILES | Nc1ccc(Sc2c(Cl)c(Cl)c(Cl)c(Cl)c2Cl)nc1 |
| InChI | InChI=1S/C11H5Cl5N2S/c12-6-7(13)9(15)11(10(16)8(6)14)19-5-2-1-4(17)3-18-5/h1-3H,17H2 |
| InChIKey | ZEGJRIBIKCCGHB-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.51 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|