C13H12Cl2N2OS — CID 43301295
6-[2-(2,6-dichlorophenoxy)ethylsulfanyl]pyridin-3-amine (PubChem CID 43301295) has the molecular formula C13H12Cl2N2OS and a molecular weight of 315.23 g/mol. Its IUPAC name is 6-[2-(2,6-dichlorophenoxy)ethylsulfanyl]pyridin-3-amine.
| Compound Name | 6-[2-(2,6-dichlorophenoxy)ethylsulfanyl]pyridin-3-amine |
|---|---|
| PubChem CID | 43301295 |
| Molecular Formula | C13H12Cl2N2OS |
| Molecular Weight | 315.23 g/mol |
| Exact Mass | 314.00 |
| IUPAC Name | 6-[2-(2,6-dichlorophenoxy)ethylsulfanyl]pyridin-3-amine |
| SMILES | Nc1ccc(SCCOc2c(Cl)cccc2Cl)nc1 |
| InChI | InChI=1S/C13H12Cl2N2OS/c14-10-2-1-3-11(15)13(10)18-6-7-19-12-5-4-9(16)8-17-12/h1-5,8H,6-7,16H2 |
| InChIKey | ZWINCIWMTPECOB-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.23 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|