C13H6F2N2O2S — CID 133477815
3-(3,4-difluorophenyl)sulfanyl-4-nitrobenzonitrile (PubChem CID 133477815) has the molecular formula C13H6F2N2O2S and a molecular weight of 292.27 g/mol. Its IUPAC name is 3-(3,4-difluorophenyl)sulfanyl-4-nitrobenzonitrile.
| Compound Name | 3-(3,4-difluorophenyl)sulfanyl-4-nitrobenzonitrile |
|---|---|
| PubChem CID | 133477815 |
| Molecular Formula | C13H6F2N2O2S |
| Molecular Weight | 292.27 g/mol |
| Exact Mass | 292.01 |
| IUPAC Name | 3-(3,4-difluorophenyl)sulfanyl-4-nitrobenzonitrile |
| SMILES | N#Cc1ccc([N+](=O)[O-])c(Sc2ccc(F)c(F)c2)c1 |
| InChI | InChI=1S/C13H6F2N2O2S/c14-10-3-2-9(6-11(10)15)20-13-5-8(7-16)1-4-12(13)17(18)19/h1-6H |
| InChIKey | XMRLGTOJEDWXGD-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 66.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.27 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|