C11H11F2NS — CID 81283930
4-tert-butylsulfanyl-3,5-difluorobenzonitrile (PubChem CID 81283930) has the molecular formula C11H11F2NS and a molecular weight of 227.28 g/mol. Its IUPAC name is 4-tert-butylsulfanyl-3,5-difluorobenzonitrile.
| Compound Name | 4-tert-butylsulfanyl-3,5-difluorobenzonitrile |
|---|---|
| PubChem CID | 81283930 |
| Molecular Formula | C11H11F2NS |
| Molecular Weight | 227.28 g/mol |
| Exact Mass | 227.06 |
| IUPAC Name | 4-tert-butylsulfanyl-3,5-difluorobenzonitrile |
| SMILES | CC(C)(C)Sc1c(F)cc(C#N)cc1F |
| InChI | InChI=1S/C11H11F2NS/c1-11(2,3)15-10-8(12)4-7(6-14)5-9(10)13/h4-5H,1-3H3 |
| InChIKey | LHIUQBNCMWNWSF-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.28 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |