C9H8F2N2 — CID 115110886
3-(dimethylamino)-4,5-difluorobenzonitrile (PubChem CID 115110886) has the molecular formula C9H8F2N2 and a molecular weight of 182.17 g/mol. Its IUPAC name is 3-(dimethylamino)-4,5-difluorobenzonitrile.
| Compound Name | 3-(dimethylamino)-4,5-difluorobenzonitrile |
|---|---|
| PubChem CID | 115110886 |
| Molecular Formula | C9H8F2N2 |
| Molecular Weight | 182.17 g/mol |
| Exact Mass | 182.07 |
| IUPAC Name | 3-(dimethylamino)-4,5-difluorobenzonitrile |
| SMILES | CN(C)c1cc(C#N)cc(F)c1F |
| InChI | InChI=1S/C9H8F2N2/c1-13(2)8-4-6(5-12)3-7(10)9(8)11/h3-4H,1-2H3 |
| InChIKey | MWDVVCXQSBZSJI-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.17 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |