C15H12F2N2 — CID 81283762
4-(N,4-dimethylanilino)-3,5-difluorobenzonitrile (PubChem CID 81283762) has the molecular formula C15H12F2N2 and a molecular weight of 258.27 g/mol. Its IUPAC name is 4-(N,4-dimethylanilino)-3,5-difluorobenzonitrile.
| Compound Name | 4-(N,4-dimethylanilino)-3,5-difluorobenzonitrile |
|---|---|
| PubChem CID | 81283762 |
| Molecular Formula | C15H12F2N2 |
| Molecular Weight | 258.27 g/mol |
| Exact Mass | 258.10 |
| IUPAC Name | 4-(N,4-dimethylanilino)-3,5-difluorobenzonitrile |
| SMILES | Cc1ccc(N(C)c2c(F)cc(C#N)cc2F)cc1 |
| InChI | InChI=1S/C15H12F2N2/c1-10-3-5-12(6-4-10)19(2)15-13(16)7-11(9-18)8-14(15)17/h3-8H,1-2H3 |
| InChIKey | COFGCBHDAWLLGB-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.27 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |