C8H4F2N2O — CID 131008452
5-cyano-2,3-difluorobenzamide (PubChem CID 131008452) has the molecular formula C8H4F2N2O and a molecular weight of 182.13 g/mol. Its IUPAC name is 5-cyano-2,3-difluorobenzamide.
| Compound Name | 5-cyano-2,3-difluorobenzamide |
|---|---|
| PubChem CID | 131008452 |
| Molecular Formula | C8H4F2N2O |
| Molecular Weight | 182.13 g/mol |
| Exact Mass | 182.03 |
| IUPAC Name | 5-cyano-2,3-difluorobenzamide |
| SMILES | N#Cc1cc(F)c(F)c(C(N)=O)c1 |
| InChI | InChI=1S/C8H4F2N2O/c9-6-2-4(3-11)1-5(7(6)10)8(12)13/h1-2H,(H2,12,13) |
| InChIKey | CVXURJVPLWDXRE-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 66.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.13 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |